C23H20F3N3O5 — CID 68994121
3-O-benzyl 1-O-methyl (2R)-2-[[[1-phenyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]methyl]propanedioate (PubChem CID 68994121) has the molecular formula C23H20F3N3O5 and a molecular weight of 475.42 g/mol. Its IUPAC name is 3-O-benzyl 1-O-methyl (2R)-2-[[[1-phenyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]methyl]propanedioate.
| Compound Name | 3-O-benzyl 1-O-methyl (2R)-2-[[[1-phenyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]methyl]propanedioate |
|---|---|
| PubChem CID | 68994121 |
| Molecular Formula | C23H20F3N3O5 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 3-O-benzyl 1-O-methyl (2R)-2-[[[1-phenyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]methyl]propanedioate |
| SMILES | COC(=O)[C@@H](CNC(=O)c1cn(-c2ccccc2)nc1C(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H20F3N3O5/c1-33-21(31)17(22(32)34-14-15-8-4-2-5-9-15)12-27-20(30)18-13-29(16-10-6-3-7-11-16)28-19(18)23(24,25)26/h2-11,13,17H,12,14H2,1H3,(H,27,30)/t17-/m1/s1 |
| InChIKey | PVAIITOVFZUZEU-QGZVFWFLSA-N |
| XLogP | 3.15 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|