C22H23NO2S — CID 68996231
(2S)-2-[[4-(2-thiophen-3-ylphenoxy)phenoxy]methyl]piperidine (PubChem CID 68996231) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is (2S)-2-[[4-(2-thiophen-3-ylphenoxy)phenoxy]methyl]piperidine.
| Compound Name | (2S)-2-[[4-(2-thiophen-3-ylphenoxy)phenoxy]methyl]piperidine |
|---|---|
| PubChem CID | 68996231 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (2S)-2-[[4-(2-thiophen-3-ylphenoxy)phenoxy]methyl]piperidine |
| SMILES | c1ccc(-c2ccsc2)c(Oc2ccc(OC[C@@H]3CCCCN3)cc2)c1 |
| InChI | InChI=1S/C22H23NO2S/c1-2-7-22(21(6-1)17-12-14-26-16-17)25-20-10-8-19(9-11-20)24-15-18-5-3-4-13-23-18/h1-2,6-12,14,16,18,23H,3-5,13,15H2/t18-/m0/s1 |
| InChIKey | NTYYWGMKMFGDKA-SFHVURJKSA-N |
| XLogP | 5.73 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |