C15H14F2N4O2 — CID 68996544
(2S)-N'-[(6-amino-3-pyridinyl)methyl]-2-(3,5-difluorophenyl)propanediamide (PubChem CID 68996544) has the molecular formula C15H14F2N4O2 and a molecular weight of 320.30 g/mol. Its IUPAC name is (2S)-N'-[(6-amino-3-pyridinyl)methyl]-2-(3,5-difluorophenyl)propanediamide.
| Compound Name | (2S)-N'-[(6-amino-3-pyridinyl)methyl]-2-(3,5-difluorophenyl)propanediamide |
|---|---|
| PubChem CID | 68996544 |
| Molecular Formula | C15H14F2N4O2 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (2S)-N'-[(6-amino-3-pyridinyl)methyl]-2-(3,5-difluorophenyl)propanediamide |
| SMILES | NC(=O)[C@@H](C(=O)NCc1ccc(N)nc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H14F2N4O2/c16-10-3-9(4-11(17)5-10)13(14(19)22)15(23)21-7-8-1-2-12(18)20-6-8/h1-6,13H,7H2,(H2,18,20)(H2,19,22)(H,21,23)/t13-/m0/s1 |
| InChIKey | MTAULPLRBKZHDE-ZDUSSCGKSA-N |
| XLogP | 0.83 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|