C16H18N4O2 — CID 68996888
(2S)-N'-[(6-amino-3-pyridinyl)methyl]-2-(3-methylphenyl)propanediamide (PubChem CID 68996888) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is (2S)-N'-[(6-amino-3-pyridinyl)methyl]-2-(3-methylphenyl)propanediamide.
| Compound Name | (2S)-N'-[(6-amino-3-pyridinyl)methyl]-2-(3-methylphenyl)propanediamide |
|---|---|
| PubChem CID | 68996888 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2S)-N'-[(6-amino-3-pyridinyl)methyl]-2-(3-methylphenyl)propanediamide |
| SMILES | Cc1cccc([C@@H](C(N)=O)C(=O)NCc2ccc(N)nc2)c1 |
| InChI | InChI=1S/C16H18N4O2/c1-10-3-2-4-12(7-10)14(15(18)21)16(22)20-9-11-5-6-13(17)19-8-11/h2-8,14H,9H2,1H3,(H2,17,19)(H2,18,21)(H,20,22)/t14-/m0/s1 |
| InChIKey | CQUUGIXMWHUWMG-AWEZNQCLSA-N |
| XLogP | 0.86 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|