C24H33N5O2 — CID 91450594
(2R)-N-[(2S)-1-[(6-amino-3-pyridinyl)methylamino]-3-(3-methylphenyl)-1-oxopropan-2-yl]-1-propan-2-ylpyrrolidine-2-carboxamide (PubChem CID 91450594) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-[(6-amino-3-pyridinyl)methylamino]-3-(3-methylphenyl)-1-oxopropan-2-yl]-1-propan-2-ylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(2S)-1-[(6-amino-3-pyridinyl)methylamino]-3-(3-methylphenyl)-1-oxopropan-2-yl]-1-propan-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91450594 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (2R)-N-[(2S)-1-[(6-amino-3-pyridinyl)methylamino]-3-(3-methylphenyl)-1-oxopropan-2-yl]-1-propan-2-ylpyrrolidine-2-carboxamide |
| SMILES | Cc1cccc(C[C@H](NC(=O)[C@H]2CCCN2C(C)C)C(=O)NCc2ccc(N)nc2)c1 |
| InChI | InChI=1S/C24H33N5O2/c1-16(2)29-11-5-8-21(29)24(31)28-20(13-18-7-4-6-17(3)12-18)23(30)27-15-19-9-10-22(25)26-14-19/h4,6-7,9-10,12,14,16,20-21H,5,8,11,13,15H2,1-3H3,(H2,25,26)(H,27,30)(H,28,31)/t20-,21+/m0/s1 |
| InChIKey | FAAFPFRFZIBCNK-LEWJYISDSA-N |
| XLogP | 2.19 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |