C22H17N3O3S — CID 68999288
4-[(E)-2-(1H-indazol-3-yl)ethenyl]-3-[(3-methylthiophene-2-carbonyl)amino]benzoic acid (PubChem CID 68999288) has the molecular formula C22H17N3O3S and a molecular weight of 403.46 g/mol. Its IUPAC name is 4-[(E)-2-(1H-indazol-3-yl)ethenyl]-3-[(3-methylthiophene-2-carbonyl)amino]benzoic acid.
| Compound Name | 4-[(E)-2-(1H-indazol-3-yl)ethenyl]-3-[(3-methylthiophene-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 68999288 |
| Molecular Formula | C22H17N3O3S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 4-[(E)-2-(1H-indazol-3-yl)ethenyl]-3-[(3-methylthiophene-2-carbonyl)amino]benzoic acid |
| SMILES | Cc1ccsc1C(=O)Nc1cc(C(=O)O)ccc1/C=C/c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C22H17N3O3S/c1-13-10-11-29-20(13)21(26)23-19-12-15(22(27)28)7-6-14(19)8-9-18-16-4-2-3-5-17(16)24-25-18/h2-12H,1H3,(H,23,26)(H,24,25)(H,27,28)/b9-8+ |
| InChIKey | MVOWGBHNJJPNIR-CMDGGOBGSA-N |
| XLogP | 5.05 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |