C27H27N5O2S — CID 91540732
N-[5-[(4-formylpiperazin-1-yl)methyl]-2-[2-(1H-indazol-3-yl)ethenyl]phenyl]-3-methylthiophene-2-carboxamide (PubChem CID 91540732) has the molecular formula C27H27N5O2S and a molecular weight of 485.61 g/mol. Its IUPAC name is N-[5-[(4-formylpiperazin-1-yl)methyl]-2-[2-(1H-indazol-3-yl)ethenyl]phenyl]-3-methylthiophene-2-carboxamide.
| Compound Name | N-[5-[(4-formylpiperazin-1-yl)methyl]-2-[2-(1H-indazol-3-yl)ethenyl]phenyl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 91540732 |
| Molecular Formula | C27H27N5O2S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | N-[5-[(4-formylpiperazin-1-yl)methyl]-2-[2-(1H-indazol-3-yl)ethenyl]phenyl]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)Nc1cc(CN2CCN(C=O)CC2)ccc1C=Cc1n[nH]c2ccccc12 |
| InChI | InChI=1S/C27H27N5O2S/c1-19-10-15-35-26(19)27(34)28-25-16-20(17-31-11-13-32(18-33)14-12-31)6-7-21(25)8-9-24-22-4-2-3-5-23(22)29-30-24/h2-10,15-16,18H,11-14,17H2,1H3,(H,28,34)(H,29,30) |
| InChIKey | FWWZJBUGQMHQDT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|