C21H32O2 — CID 69000068
(2,2,8,8-tetramethyl-4-methylidenenonan-5-yl) benzoate (PubChem CID 69000068) has the molecular formula C21H32O2 and a molecular weight of 316.48 g/mol. Its IUPAC name is (2,2,8,8-tetramethyl-4-methylidenenonan-5-yl) benzoate.
| Compound Name | (2,2,8,8-tetramethyl-4-methylidenenonan-5-yl) benzoate |
|---|---|
| PubChem CID | 69000068 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (2,2,8,8-tetramethyl-4-methylidenenonan-5-yl) benzoate |
| SMILES | C=C(CC(C)(C)C)C(CCC(C)(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H32O2/c1-16(15-21(5,6)7)18(13-14-20(2,3)4)23-19(22)17-11-9-8-10-12-17/h8-12,18H,1,13-15H2,2-7H3 |
| InChIKey | QTOBRKZYYMIQFE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|