C16H21FN2O3 — CID 69000949
tert-butyl 6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-carboxylate (PubChem CID 69000949) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is tert-butyl 6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 69000949 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | tert-butyl 6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)OCc1cc(F)ncc12 |
| InChI | InChI=1S/C16H21FN2O3/c1-15(2,3)22-14(20)19-6-4-16(5-7-19)12-9-18-13(17)8-11(12)10-21-16/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | LKAMHQZYJLKHBE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|