C21H17N3O2S — CID 69002102
N-[2-[2-(1H-indazol-3-yl)ethenyl]phenyl]benzenesulfonamide (PubChem CID 69002102) has the molecular formula C21H17N3O2S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-[2-[2-(1H-indazol-3-yl)ethenyl]phenyl]benzenesulfonamide.
| Compound Name | N-[2-[2-(1H-indazol-3-yl)ethenyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69002102 |
| Molecular Formula | C21H17N3O2S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-[2-[2-(1H-indazol-3-yl)ethenyl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1C=Cc1n[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C21H17N3O2S/c25-27(26,17-9-2-1-3-10-17)24-19-12-6-4-8-16(19)14-15-21-18-11-5-7-13-20(18)22-23-21/h1-15,24H,(H,22,23) |
| InChIKey | KMNWVPVCWDNTNR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |