C19H11Cl2N3O2 — CID 69004356
3,4-dichloro-1-[2-[2-(1H-indazol-3-yl)ethenyl]phenyl]pyrrole-2,5-dione (PubChem CID 69004356) has the molecular formula C19H11Cl2N3O2 and a molecular weight of 384.22 g/mol. Its IUPAC name is 3,4-dichloro-1-[2-[2-(1H-indazol-3-yl)ethenyl]phenyl]pyrrole-2,5-dione.
| Compound Name | 3,4-dichloro-1-[2-[2-(1H-indazol-3-yl)ethenyl]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 69004356 |
| Molecular Formula | C19H11Cl2N3O2 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 3,4-dichloro-1-[2-[2-(1H-indazol-3-yl)ethenyl]phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)N1c1ccccc1C=Cc1n[nH]c2ccccc12 |
| InChI | InChI=1S/C19H11Cl2N3O2/c20-16-17(21)19(26)24(18(16)25)15-8-4-1-5-11(15)9-10-14-12-6-2-3-7-13(12)22-23-14/h1-10H,(H,22,23) |
| InChIKey | RVLILJKHGFILNY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|