C17H13ClF3N3O3 — CID 69003899
N-[(2-chlorophenyl)methyl]-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;2,2,2-trifluoroacetate (PubChem CID 69003899) has the molecular formula C17H13ClF3N3O3 and a molecular weight of 399.76 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;2,2,2-trifluoroacetate.
| Compound Name | N-[(2-chlorophenyl)methyl]-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69003899 |
| Molecular Formula | C17H13ClF3N3O3 |
| Molecular Weight | 399.76 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;2,2,2-trifluoroacetate |
| SMILES | O=C(NCc1ccccc1Cl)c1[nH]c[n+]2ccccc12.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C15H12ClN3O.C2HF3O2/c16-12-6-2-1-5-11(12)9-17-15(20)14-13-7-3-4-8-19(13)10-18-14;3-2(4,5)1(6)7/h1-8,10H,9H2,(H,17,20);(H,6,7) |
| InChIKey | GTPPTHSBQRMFPX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.76 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|