C23H25F3N2O3 — CID 69003956
4-[2-(cyclohexylamino)-1-(3-methoxyphenyl)-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 69003956) has the molecular formula C23H25F3N2O3 and a molecular weight of 434.46 g/mol. Its IUPAC name is 4-[2-(cyclohexylamino)-1-(3-methoxyphenyl)-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 4-[2-(cyclohexylamino)-1-(3-methoxyphenyl)-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 69003956 |
| Molecular Formula | C23H25F3N2O3 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 4-[2-(cyclohexylamino)-1-(3-methoxyphenyl)-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | COc1cccc(C(C(=O)NC2CCCCC2)c2ccc(C(N)=O)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C23H25F3N2O3/c1-31-17-9-5-6-14(12-17)20(22(30)28-16-7-3-2-4-8-16)18-11-10-15(21(27)29)13-19(18)23(24,25)26/h5-6,9-13,16,20H,2-4,7-8H2,1H3,(H2,27,29)(H,28,30) |
| InChIKey | NJDHKLHSINXOSY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |