C16H23NO3Si — CID 69006126
2-ethyl-2-(4-methoxyanilino)-4-trimethylsilylbut-3-ynoic acid (PubChem CID 69006126) has the molecular formula C16H23NO3Si and a molecular weight of 305.45 g/mol. Its IUPAC name is 2-ethyl-2-(4-methoxyanilino)-4-trimethylsilylbut-3-ynoic acid.
| Compound Name | 2-ethyl-2-(4-methoxyanilino)-4-trimethylsilylbut-3-ynoic acid |
|---|---|
| PubChem CID | 69006126 |
| Molecular Formula | C16H23NO3Si |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-ethyl-2-(4-methoxyanilino)-4-trimethylsilylbut-3-ynoic acid |
| SMILES | CCC(C#C[Si](C)(C)C)(Nc1ccc(OC)cc1)C(=O)O |
| InChI | InChI=1S/C16H23NO3Si/c1-6-16(15(18)19,11-12-21(3,4)5)17-13-7-9-14(20-2)10-8-13/h7-10,17H,6H2,1-5H3,(H,18,19) |
| InChIKey | HZHWNSFVQPMMDT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|