C27H33N3O3 — CID 69010475
1,3,5-tris[(4-methoxyphenyl)methyl]triazinane (PubChem CID 69010475) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 1,3,5-tris[(4-methoxyphenyl)methyl]triazinane.
| Compound Name | 1,3,5-tris[(4-methoxyphenyl)methyl]triazinane |
|---|---|
| PubChem CID | 69010475 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 1,3,5-tris[(4-methoxyphenyl)methyl]triazinane |
| SMILES | COc1ccc(CC2CN(Cc3ccc(OC)cc3)NN(Cc3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C27H33N3O3/c1-31-25-10-4-21(5-11-25)16-24-19-29(17-22-6-12-26(32-2)13-7-22)28-30(20-24)18-23-8-14-27(33-3)15-9-23/h4-15,24,28H,16-20H2,1-3H3 |
| InChIKey | FPIXYTPUHGTYRQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |