C20H17F2NO3 — CID 69014436
2,3-difluoro-6-[[3-(4-methoxyphenoxy)phenyl]methylamino]phenol (PubChem CID 69014436) has the molecular formula C20H17F2NO3 and a molecular weight of 357.36 g/mol. Its IUPAC name is 2,3-difluoro-6-[[3-(4-methoxyphenoxy)phenyl]methylamino]phenol.
| Compound Name | 2,3-difluoro-6-[[3-(4-methoxyphenoxy)phenyl]methylamino]phenol |
|---|---|
| PubChem CID | 69014436 |
| Molecular Formula | C20H17F2NO3 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2,3-difluoro-6-[[3-(4-methoxyphenoxy)phenyl]methylamino]phenol |
| SMILES | COc1ccc(Oc2cccc(CNc3ccc(F)c(F)c3O)c2)cc1 |
| InChI | InChI=1S/C20H17F2NO3/c1-25-14-5-7-15(8-6-14)26-16-4-2-3-13(11-16)12-23-18-10-9-17(21)19(22)20(18)24/h2-11,23-24H,12H2,1H3 |
| InChIKey | QAPRMXRNFNLNCQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|