C24H25Cl2NO2 — CID 58828938
6-[[3-(4-tert-butylphenoxy)phenyl]methylamino]-2,4-dichloro-3-methylphenol (PubChem CID 58828938) has the molecular formula C24H25Cl2NO2 and a molecular weight of 430.38 g/mol. Its IUPAC name is 6-[[3-(4-tert-butylphenoxy)phenyl]methylamino]-2,4-dichloro-3-methylphenol.
| Compound Name | 6-[[3-(4-tert-butylphenoxy)phenyl]methylamino]-2,4-dichloro-3-methylphenol |
|---|---|
| PubChem CID | 58828938 |
| Molecular Formula | C24H25Cl2NO2 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 6-[[3-(4-tert-butylphenoxy)phenyl]methylamino]-2,4-dichloro-3-methylphenol |
| SMILES | Cc1c(Cl)cc(NCc2cccc(Oc3ccc(C(C)(C)C)cc3)c2)c(O)c1Cl |
| InChI | InChI=1S/C24H25Cl2NO2/c1-15-20(25)13-21(23(28)22(15)26)27-14-16-6-5-7-19(12-16)29-18-10-8-17(9-11-18)24(2,3)4/h5-13,27-28H,14H2,1-4H3 |
| InChIKey | GNAJKYOXAJEIQV-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|