C24H19N3O5 — CID 69018298
2-acetamido-N-[6-(4-oxo-2-phenylchromen-6-yl)oxy-3-pyridinyl]acetamide (PubChem CID 69018298) has the molecular formula C24H19N3O5 and a molecular weight of 429.43 g/mol. Its IUPAC name is 2-acetamido-N-[6-(4-oxo-2-phenylchromen-6-yl)oxy-3-pyridinyl]acetamide.
| Compound Name | 2-acetamido-N-[6-(4-oxo-2-phenylchromen-6-yl)oxy-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 69018298 |
| Molecular Formula | C24H19N3O5 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 2-acetamido-N-[6-(4-oxo-2-phenylchromen-6-yl)oxy-3-pyridinyl]acetamide |
| SMILES | CC(=O)NCC(=O)Nc1ccc(Oc2ccc3oc(-c4ccccc4)cc(=O)c3c2)nc1 |
| InChI | InChI=1S/C24H19N3O5/c1-15(28)25-14-23(30)27-17-7-10-24(26-13-17)31-18-8-9-21-19(11-18)20(29)12-22(32-21)16-5-3-2-4-6-16/h2-13H,14H2,1H3,(H,25,28)(H,27,30) |
| InChIKey | CXSSIOVJUXEKGL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |