C26H22ClNO5 — CID 108754377
4-(2-chlorophenoxy)-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]butanamide (PubChem CID 108754377) has the molecular formula C26H22ClNO5 and a molecular weight of 463.92 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]butanamide.
| Compound Name | 4-(2-chlorophenoxy)-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 108754377 |
| Molecular Formula | C26H22ClNO5 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 4-(2-chlorophenoxy)-N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]butanamide |
| SMILES | COc1ccc2oc(-c3ccc(NC(=O)CCCOc4ccccc4Cl)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C26H22ClNO5/c1-31-19-12-13-23-20(15-19)22(29)16-25(33-23)17-8-10-18(11-9-17)28-26(30)7-4-14-32-24-6-3-2-5-21(24)27/h2-3,5-6,8-13,15-16H,4,7,14H2,1H3,(H,28,30) |
| InChIKey | DDYNTUJIWGDXFB-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|