C24H19NO5S — CID 108730744
N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]-4-oxo-4-thiophen-2-ylbutanamide (PubChem CID 108730744) has the molecular formula C24H19NO5S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]-4-oxo-4-thiophen-2-ylbutanamide.
| Compound Name | N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]-4-oxo-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 108730744 |
| Molecular Formula | C24H19NO5S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-[4-(6-methoxy-4-oxochromen-2-yl)phenyl]-4-oxo-4-thiophen-2-ylbutanamide |
| SMILES | COc1ccc2oc(-c3ccc(NC(=O)CCC(=O)c4cccs4)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C24H19NO5S/c1-29-17-8-10-21-18(13-17)20(27)14-22(30-21)15-4-6-16(7-5-15)25-24(28)11-9-19(26)23-3-2-12-31-23/h2-8,10,12-14H,9,11H2,1H3,(H,25,28) |
| InChIKey | OQIGYPIBFDTKLQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |