C33H50N4O5 — CID 69019269
methyl (2S)-1-[(E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoyl]-2,5-dihydropyrrole-2-carboxylate (PubChem CID 69019269) has the molecular formula C33H50N4O5 and a molecular weight of 582.79 g/mol. Its IUPAC name is methyl (2S)-1-[(E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoyl]-2,5-dihydropyrrole-2-carboxylate.
| Compound Name | methyl (2S)-1-[(E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoyl]-2,5-dihydropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 69019269 |
| Molecular Formula | C33H50N4O5 |
| Molecular Weight | 582.79 g/mol |
| Exact Mass | 582.38 |
| IUPAC Name | methyl (2S)-1-[(E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoyl]-2,5-dihydropyrrole-2-carboxylate |
| SMILES | CN[C@H](C(=O)N[C@H](C(=O)N(C)[C@H](/C=C(\C)C(=O)N1CC=C[C@H]1C(=O)OC)C(C)C)C(C)(C)C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C33H50N4O5/c1-21(2)25(20-22(3)29(39)37-19-15-18-24(37)31(41)42-11)36(10)30(40)27(32(4,5)6)35-28(38)26(34-9)33(7,8)23-16-13-12-14-17-23/h12-18,20-21,24-27,34H,19H2,1-11H3,(H,35,38)/b22-20+/t24-,25+,26+,27+/m0/s1 |
| InChIKey | KAKQLFHTJRDQDJ-DUEBQHBBSA-N |
| XLogP | 3.45 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.79 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|