C13H26N2 — CID 69020260
3-butyl-5-hexyl-1,2-dihydroimidazole (PubChem CID 69020260) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 3-butyl-5-hexyl-1,2-dihydroimidazole.
| Compound Name | 3-butyl-5-hexyl-1,2-dihydroimidazole |
|---|---|
| PubChem CID | 69020260 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 3-butyl-5-hexyl-1,2-dihydroimidazole |
| SMILES | CCCCCCC1=CN(CCCC)CN1 |
| InChI | InChI=1S/C13H26N2/c1-3-5-7-8-9-13-11-15(12-14-13)10-6-4-2/h11,14H,3-10,12H2,1-2H3 |
| InChIKey | KSHQFBCNHYKKGT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|