C20H23N7O2 — CID 69021654
4-N-[2-(4-methylphenyl)ethyl]-2-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 69021654) has the molecular formula C20H23N7O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is 4-N-[2-(4-methylphenyl)ethyl]-2-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[2-(4-methylphenyl)ethyl]-2-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 69021654 |
| Molecular Formula | C20H23N7O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 4-N-[2-(4-methylphenyl)ethyl]-2-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1ccc(CCNc2nc(N)nc(N[C@@H](C)c3ccc([N+](=O)[O-])cc3)n2)cc1 |
| InChI | InChI=1S/C20H23N7O2/c1-13-3-5-15(6-4-13)11-12-22-19-24-18(21)25-20(26-19)23-14(2)16-7-9-17(10-8-16)27(28)29/h3-10,14H,11-12H2,1-2H3,(H4,21,22,23,24,25,26)/t14-/m0/s1 |
| InChIKey | MPVUIYWXKQWUSE-AWEZNQCLSA-N |
| XLogP | 3.50 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|