C8H8N2S — CID 690255
5,6-dimethyl-2,1,3-benzothiadiazole (PubChem CID 690255) has the molecular formula C8H8N2S and a molecular weight of 164.23 g/mol. Its IUPAC name is 5,6-dimethyl-2,1,3-benzothiadiazole.
| Compound Name | 5,6-dimethyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 690255 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 5,6-dimethyl-2,1,3-benzothiadiazole |
| SMILES | Cc1cc2nsnc2cc1C |
| InChI | InChI=1S/C8H8N2S/c1-5-3-7-8(4-6(5)2)10-11-9-7/h3-4H,1-2H3 |
| InChIKey | QQCMLCGOLBUDJF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |