C19H19N5O2S — CID 6902564
[(E)-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea (PubChem CID 6902564) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is [(E)-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea.
| Compound Name | [(E)-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 6902564 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [(E)-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=N/NC(N)=S)cc1OC |
| InChI | InChI=1S/C19H19N5O2S/c1-25-16-9-8-13(10-17(16)26-2)18-14(11-21-22-19(20)27)12-24(23-18)15-6-4-3-5-7-15/h3-12H,1-2H3,(H3,20,22,27)/b21-11+ |
| InChIKey | GXYGKYDRUGRFRE-SRZZPIQSSA-N |
| XLogP | 2.72 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|