C25H30N4O2 — CID 69026453
4-ethyl-5-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2-pyridin-2-ylpyridazin-3-one (PubChem CID 69026453) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 4-ethyl-5-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2-pyridin-2-ylpyridazin-3-one.
| Compound Name | 4-ethyl-5-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2-pyridin-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 69026453 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 4-ethyl-5-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2-pyridin-2-ylpyridazin-3-one |
| SMILES | CCc1c(-c2ccc(OCCCN3CCC[C@H]3C)cc2)cnn(-c2ccccn2)c1=O |
| InChI | InChI=1S/C25H30N4O2/c1-3-22-23(18-27-29(25(22)30)24-9-4-5-14-26-24)20-10-12-21(13-11-20)31-17-7-16-28-15-6-8-19(28)2/h4-5,9-14,18-19H,3,6-8,15-17H2,1-2H3/t19-/m1/s1 |
| InChIKey | CFADSSVDEKGBAT-LJQANCHMSA-N |
| XLogP | 4.11 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|