About 5-butyl-1-nitrotetrazole
5-butyl-1-nitrotetrazole (PubChem CID 69033000) has the molecular formula C5H9N5O2
and a molecular weight of 171.16 g/mol. Its IUPAC name is 5-butyl-1-nitrotetrazole.
Molecular Properties
| Compound Name | 5-butyl-1-nitrotetrazole |
| PubChem CID | 69033000 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 5-butyl-1-nitrotetrazole |
| SMILES | CCCCc1nnnn1[N+](=O)[O-] |
| InChI | InChI=1S/C5H9N5O2/c1-2-3-4-5-6-7-8-9(5)10(11)12/h2-4H2,1H3 |
| InChIKey | VEUALBZRNRRKKK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-butyl-1-nitrotetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-1-nitrotetrazole?
The IUPAC name of 5-butyl-1-nitrotetrazole (CID 69033000) is 5-butyl-1-nitrotetrazole.
What is the SMILES notation for 5-butyl-1-nitrotetrazole?
The canonical SMILES for 5-butyl-1-nitrotetrazole is CCCCc1nnnn1[N+](=O)[O-].
What is the InChIKey of 5-butyl-1-nitrotetrazole?
The InChIKey is VEUALBZRNRRKKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5O2/c1-2-3-4-5-6-7-8-9(5)10(11)12/h2-4H2,1H3.
What are the key properties of 5-butyl-1-nitrotetrazole?
5-butyl-1-nitrotetrazole has a molecular weight of 171.16 g/mol, XLogP of 0.06, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-1-nitrotetrazole is sourced from PubChem (CID 69033000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).