C9H13F5N4 — CID 87665284
5-hexyl-1-(1,1,2,2,2-pentafluoroethyl)tetrazole (PubChem CID 87665284) has the molecular formula C9H13F5N4 and a molecular weight of 272.22 g/mol. Its IUPAC name is 5-hexyl-1-(1,1,2,2,2-pentafluoroethyl)tetrazole.
| Compound Name | 5-hexyl-1-(1,1,2,2,2-pentafluoroethyl)tetrazole |
|---|---|
| PubChem CID | 87665284 |
| Molecular Formula | C9H13F5N4 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 5-hexyl-1-(1,1,2,2,2-pentafluoroethyl)tetrazole |
| SMILES | CCCCCCc1nnnn1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H13F5N4/c1-2-3-4-5-6-7-15-16-17-18(7)9(13,14)8(10,11)12/h2-6H2,1H3 |
| InChIKey | ZJJSRCITZFBEEP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|