C14H25F2N3 — CID 155313395
1-butyl-4-(1,1-difluoropropyl)-5-pentyltriazole (PubChem CID 155313395) has the molecular formula C14H25F2N3 and a molecular weight of 273.37 g/mol. Its IUPAC name is 1-butyl-4-(1,1-difluoropropyl)-5-pentyltriazole.
| Compound Name | 1-butyl-4-(1,1-difluoropropyl)-5-pentyltriazole |
|---|---|
| PubChem CID | 155313395 |
| Molecular Formula | C14H25F2N3 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 1-butyl-4-(1,1-difluoropropyl)-5-pentyltriazole |
| SMILES | CCCCCc1c(C(F)(F)CC)nnn1CCCC |
| InChI | InChI=1S/C14H25F2N3/c1-4-7-9-10-12-13(14(15,16)6-3)17-18-19(12)11-8-5-2/h4-11H2,1-3H3 |
| InChIKey | VEDAWAZRBYJTAX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|