C14H22F5N3 — CID 87804473
4-tert-butyl-1-hexyl-5-(1,1,2,2,2-pentafluoroethyl)triazole (PubChem CID 87804473) has the molecular formula C14H22F5N3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 4-tert-butyl-1-hexyl-5-(1,1,2,2,2-pentafluoroethyl)triazole.
| Compound Name | 4-tert-butyl-1-hexyl-5-(1,1,2,2,2-pentafluoroethyl)triazole |
|---|---|
| PubChem CID | 87804473 |
| Molecular Formula | C14H22F5N3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 4-tert-butyl-1-hexyl-5-(1,1,2,2,2-pentafluoroethyl)triazole |
| SMILES | CCCCCCn1nnc(C(C)(C)C)c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H22F5N3/c1-5-6-7-8-9-22-11(13(15,16)14(17,18)19)10(20-21-22)12(2,3)4/h5-9H2,1-4H3 |
| InChIKey | CYAWVBFYADNQTD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|