C9H7Cl5F5N3 — CID 87804685
4-(1,1,2,2,2-pentachloroethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-propyltriazole (PubChem CID 87804685) has the molecular formula C9H7Cl5F5N3 and a molecular weight of 429.43 g/mol. Its IUPAC name is 4-(1,1,2,2,2-pentachloroethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-propyltriazole.
| Compound Name | 4-(1,1,2,2,2-pentachloroethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-propyltriazole |
|---|---|
| PubChem CID | 87804685 |
| Molecular Formula | C9H7Cl5F5N3 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 426.90 |
| IUPAC Name | 4-(1,1,2,2,2-pentachloroethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1-propyltriazole |
| SMILES | CCCn1nnc(C(Cl)(Cl)C(Cl)(Cl)Cl)c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H7Cl5F5N3/c1-2-3-22-5(7(15,16)9(17,18)19)4(20-21-22)6(10,11)8(12,13)14/h2-3H2,1H3 |
| InChIKey | BALPIJSCNUPKFF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|