C8H10Cl5N3 — CID 69388577
1,5-diethyl-4-(1,1,2,2,2-pentachloroethyl)triazole (PubChem CID 69388577) has the molecular formula C8H10Cl5N3 and a molecular weight of 325.45 g/mol. Its IUPAC name is 1,5-diethyl-4-(1,1,2,2,2-pentachloroethyl)triazole.
| Compound Name | 1,5-diethyl-4-(1,1,2,2,2-pentachloroethyl)triazole |
|---|---|
| PubChem CID | 69388577 |
| Molecular Formula | C8H10Cl5N3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 322.93 |
| IUPAC Name | 1,5-diethyl-4-(1,1,2,2,2-pentachloroethyl)triazole |
| SMILES | CCc1c(C(Cl)(Cl)C(Cl)(Cl)Cl)nnn1CC |
| InChI | InChI=1S/C8H10Cl5N3/c1-3-5-6(14-15-16(5)4-2)7(9,10)8(11,12)13/h3-4H2,1-2H3 |
| InChIKey | IXRUAPQJUMXJFJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|