C10H19N3 — CID 69387762
4-butyl-1,5-diethyltriazole (PubChem CID 69387762) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-butyl-1,5-diethyltriazole.
| Compound Name | 4-butyl-1,5-diethyltriazole |
|---|---|
| PubChem CID | 69387762 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 4-butyl-1,5-diethyltriazole |
| SMILES | CCCCc1nnn(CC)c1CC |
| InChI | InChI=1S/C10H19N3/c1-4-7-8-9-10(5-2)13(6-3)12-11-9/h4-8H2,1-3H3 |
| InChIKey | OZVMJTHOTLWNIK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |