C6H5Cl5FN3 — CID 87804221
1-ethyl-5-fluoro-4-(1,1,2,2,2-pentachloroethyl)triazole (PubChem CID 87804221) has the molecular formula C6H5Cl5FN3 and a molecular weight of 315.39 g/mol. Its IUPAC name is 1-ethyl-5-fluoro-4-(1,1,2,2,2-pentachloroethyl)triazole.
| Compound Name | 1-ethyl-5-fluoro-4-(1,1,2,2,2-pentachloroethyl)triazole |
|---|---|
| PubChem CID | 87804221 |
| Molecular Formula | C6H5Cl5FN3 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 312.89 |
| IUPAC Name | 1-ethyl-5-fluoro-4-(1,1,2,2,2-pentachloroethyl)triazole |
| SMILES | CCn1nnc(C(Cl)(Cl)C(Cl)(Cl)Cl)c1F |
| InChI | InChI=1S/C6H5Cl5FN3/c1-2-15-4(12)3(13-14-15)5(7,8)6(9,10)11/h2H2,1H3 |
| InChIKey | BYJXVYNDZGFRTC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|