C8H7Cl8N3 — CID 87804301
5-(1,1,2,2,2-pentachloroethyl)-1-propyl-4-(trichloromethyl)triazole (PubChem CID 87804301) has the molecular formula C8H7Cl8N3 and a molecular weight of 428.79 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentachloroethyl)-1-propyl-4-(trichloromethyl)triazole.
| Compound Name | 5-(1,1,2,2,2-pentachloroethyl)-1-propyl-4-(trichloromethyl)triazole |
|---|---|
| PubChem CID | 87804301 |
| Molecular Formula | C8H7Cl8N3 |
| Molecular Weight | 428.79 g/mol |
| Exact Mass | 424.81 |
| IUPAC Name | 5-(1,1,2,2,2-pentachloroethyl)-1-propyl-4-(trichloromethyl)triazole |
| SMILES | CCCn1nnc(C(Cl)(Cl)Cl)c1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H7Cl8N3/c1-2-3-19-5(6(9,10)8(14,15)16)4(17-18-19)7(11,12)13/h2-3H2,1H3 |
| InChIKey | XVOQPCYHGGPJMZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.79 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|