C7H8Cl5N3 — CID 69388134
4-ethyl-1-methyl-5-(1,1,2,2,2-pentachloroethyl)triazole (PubChem CID 69388134) has the molecular formula C7H8Cl5N3 and a molecular weight of 311.43 g/mol. Its IUPAC name is 4-ethyl-1-methyl-5-(1,1,2,2,2-pentachloroethyl)triazole.
| Compound Name | 4-ethyl-1-methyl-5-(1,1,2,2,2-pentachloroethyl)triazole |
|---|---|
| PubChem CID | 69388134 |
| Molecular Formula | C7H8Cl5N3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 308.92 |
| IUPAC Name | 4-ethyl-1-methyl-5-(1,1,2,2,2-pentachloroethyl)triazole |
| SMILES | CCc1nnn(C)c1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H8Cl5N3/c1-3-4-5(15(2)14-13-4)6(8,9)7(10,11)12/h3H2,1-2H3 |
| InChIKey | TUKSOXZWIAUZSI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|