C12H18Cl5N3 — CID 69382460
4-(2,2-dimethylpropyl)-5-(1,1,2,2,2-pentachloroethyl)-1-propan-2-yltriazole (PubChem CID 69382460) has the molecular formula C12H18Cl5N3 and a molecular weight of 381.56 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-5-(1,1,2,2,2-pentachloroethyl)-1-propan-2-yltriazole.
| Compound Name | 4-(2,2-dimethylpropyl)-5-(1,1,2,2,2-pentachloroethyl)-1-propan-2-yltriazole |
|---|---|
| PubChem CID | 69382460 |
| Molecular Formula | C12H18Cl5N3 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-5-(1,1,2,2,2-pentachloroethyl)-1-propan-2-yltriazole |
| SMILES | CC(C)n1nnc(CC(C)(C)C)c1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H18Cl5N3/c1-7(2)20-9(11(13,14)12(15,16)17)8(18-19-20)6-10(3,4)5/h7H,6H2,1-5H3 |
| InChIKey | GCNUCWCDBQDOOJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|