C9H7F10N3 — CID 87803610
4,5-bis(1,1,2,2,2-pentafluoroethyl)-1-propan-2-yltriazole (PubChem CID 87803610) has the molecular formula C9H7F10N3 and a molecular weight of 347.16 g/mol. Its IUPAC name is 4,5-bis(1,1,2,2,2-pentafluoroethyl)-1-propan-2-yltriazole.
| Compound Name | 4,5-bis(1,1,2,2,2-pentafluoroethyl)-1-propan-2-yltriazole |
|---|---|
| PubChem CID | 87803610 |
| Molecular Formula | C9H7F10N3 |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 4,5-bis(1,1,2,2,2-pentafluoroethyl)-1-propan-2-yltriazole |
| SMILES | CC(C)n1nnc(C(F)(F)C(F)(F)F)c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H7F10N3/c1-3(2)22-5(7(12,13)9(17,18)19)4(20-21-22)6(10,11)8(14,15)16/h3H,1-2H3 |
| InChIKey | HDWRNNCXAPKUJW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|