C8H7F8N3 — CID 87805837
4-(1,1,2,2,2-pentafluoroethyl)-1-propan-2-yl-5-(trifluoromethyl)triazole (PubChem CID 87805837) has the molecular formula C8H7F8N3 and a molecular weight of 297.15 g/mol. Its IUPAC name is 4-(1,1,2,2,2-pentafluoroethyl)-1-propan-2-yl-5-(trifluoromethyl)triazole.
| Compound Name | 4-(1,1,2,2,2-pentafluoroethyl)-1-propan-2-yl-5-(trifluoromethyl)triazole |
|---|---|
| PubChem CID | 87805837 |
| Molecular Formula | C8H7F8N3 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 4-(1,1,2,2,2-pentafluoroethyl)-1-propan-2-yl-5-(trifluoromethyl)triazole |
| SMILES | CC(C)n1nnc(C(F)(F)C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C8H7F8N3/c1-3(2)19-5(7(11,12)13)4(17-18-19)6(9,10)8(14,15)16/h3H,1-2H3 |
| InChIKey | AVBSFUPSGRJNDB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|