C5H3ClF5N3 — CID 87804715
4-chloro-1-methyl-5-(1,1,2,2,2-pentafluoroethyl)triazole (PubChem CID 87804715) has the molecular formula C5H3ClF5N3 and a molecular weight of 235.54 g/mol. Its IUPAC name is 4-chloro-1-methyl-5-(1,1,2,2,2-pentafluoroethyl)triazole.
| Compound Name | 4-chloro-1-methyl-5-(1,1,2,2,2-pentafluoroethyl)triazole |
|---|---|
| PubChem CID | 87804715 |
| Molecular Formula | C5H3ClF5N3 |
| Molecular Weight | 235.54 g/mol |
| Exact Mass | 234.99 |
| IUPAC Name | 4-chloro-1-methyl-5-(1,1,2,2,2-pentafluoroethyl)triazole |
| SMILES | Cn1nnc(Cl)c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H3ClF5N3/c1-14-2(3(6)12-13-14)4(7,8)5(9,10)11/h1H3 |
| InChIKey | CNHNMECEMDXSKY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.54 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|