C10H9Cl5N6O — CID 91289427
[4-(1,1,2,2,2-pentachloroethyl)-5-propyltriazol-1-yl]-(triazol-1-yl)methanone (PubChem CID 91289427) has the molecular formula C10H9Cl5N6O and a molecular weight of 406.49 g/mol. Its IUPAC name is [4-(1,1,2,2,2-pentachloroethyl)-5-propyltriazol-1-yl]-(triazol-1-yl)methanone.
| Compound Name | [4-(1,1,2,2,2-pentachloroethyl)-5-propyltriazol-1-yl]-(triazol-1-yl)methanone |
|---|---|
| PubChem CID | 91289427 |
| Molecular Formula | C10H9Cl5N6O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 403.93 |
| IUPAC Name | [4-(1,1,2,2,2-pentachloroethyl)-5-propyltriazol-1-yl]-(triazol-1-yl)methanone |
| SMILES | CCCc1c(C(Cl)(Cl)C(Cl)(Cl)Cl)nnn1C(=O)n1ccnn1 |
| InChI | InChI=1S/C10H9Cl5N6O/c1-2-3-6-7(9(11,12)10(13,14)15)17-19-21(6)8(22)20-5-4-16-18-20/h4-5H,2-3H2,1H3 |
| InChIKey | IGJPPLQIIHCLQS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|