C7H2F6N6O — CID 91161392
[5-fluoro-4-(1,1,2,2,2-pentafluoroethyl)triazol-1-yl]-(triazol-1-yl)methanone (PubChem CID 91161392) has the molecular formula C7H2F6N6O and a molecular weight of 300.12 g/mol. Its IUPAC name is [5-fluoro-4-(1,1,2,2,2-pentafluoroethyl)triazol-1-yl]-(triazol-1-yl)methanone.
| Compound Name | [5-fluoro-4-(1,1,2,2,2-pentafluoroethyl)triazol-1-yl]-(triazol-1-yl)methanone |
|---|---|
| PubChem CID | 91161392 |
| Molecular Formula | C7H2F6N6O |
| Molecular Weight | 300.12 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | [5-fluoro-4-(1,1,2,2,2-pentafluoroethyl)triazol-1-yl]-(triazol-1-yl)methanone |
| SMILES | O=C(n1ccnn1)n1nnc(C(F)(F)C(F)(F)F)c1F |
| InChI | InChI=1S/C7H2F6N6O/c8-4-3(6(9,10)7(11,12)13)15-17-19(4)5(20)18-2-1-14-16-18/h1-2H |
| InChIKey | RPOFROGIGHDVDI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.12 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|