C17H12N6O — CID 91155285
(4,5-diphenyltriazol-1-yl)-(triazol-1-yl)methanone (PubChem CID 91155285) has the molecular formula C17H12N6O and a molecular weight of 316.32 g/mol. Its IUPAC name is (4,5-diphenyltriazol-1-yl)-(triazol-1-yl)methanone.
| Compound Name | (4,5-diphenyltriazol-1-yl)-(triazol-1-yl)methanone |
|---|---|
| PubChem CID | 91155285 |
| Molecular Formula | C17H12N6O |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (4,5-diphenyltriazol-1-yl)-(triazol-1-yl)methanone |
| SMILES | O=C(n1ccnn1)n1nnc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C17H12N6O/c24-17(22-12-11-18-20-22)23-16(14-9-5-2-6-10-14)15(19-21-23)13-7-3-1-4-8-13/h1-12H |
| InChIKey | KZJGXWQCFHJPES-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |