C13H20F5N3 — CID 87804159
1-hexyl-4-(1,1,2,2,2-pentafluoroethyl)-5-propyltriazole (PubChem CID 87804159) has the molecular formula C13H20F5N3 and a molecular weight of 313.31 g/mol. Its IUPAC name is 1-hexyl-4-(1,1,2,2,2-pentafluoroethyl)-5-propyltriazole.
| Compound Name | 1-hexyl-4-(1,1,2,2,2-pentafluoroethyl)-5-propyltriazole |
|---|---|
| PubChem CID | 87804159 |
| Molecular Formula | C13H20F5N3 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-hexyl-4-(1,1,2,2,2-pentafluoroethyl)-5-propyltriazole |
| SMILES | CCCCCCn1nnc(C(F)(F)C(F)(F)F)c1CCC |
| InChI | InChI=1S/C13H20F5N3/c1-3-5-6-7-9-21-10(8-4-2)11(19-20-21)12(14,15)13(16,17)18/h3-9H2,1-2H3 |
| InChIKey | YPHYVSNLDVUCFU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|