C16H31N3 — CID 69387197
4,5-ditert-butyl-1-hexyltriazole (PubChem CID 69387197) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is 4,5-ditert-butyl-1-hexyltriazole.
| Compound Name | 4,5-ditert-butyl-1-hexyltriazole |
|---|---|
| PubChem CID | 69387197 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | 4,5-ditert-butyl-1-hexyltriazole |
| SMILES | CCCCCCn1nnc(C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C16H31N3/c1-8-9-10-11-12-19-14(16(5,6)7)13(17-18-19)15(2,3)4/h8-12H2,1-7H3 |
| InChIKey | OBAAOEPJUZXVEN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|