C4F8N4 — CID 87665075
1-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)tetrazole (PubChem CID 87665075) has the molecular formula C4F8N4 and a molecular weight of 256.06 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)tetrazole.
| Compound Name | 1-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)tetrazole |
|---|---|
| PubChem CID | 87665075 |
| Molecular Formula | C4F8N4 |
| Molecular Weight | 256.06 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 1-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)tetrazole |
| SMILES | FC(F)(F)c1nnnn1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4F8N4/c5-2(6,7)1-13-14-15-16(1)4(11,12)3(8,9)10 |
| InChIKey | XUSBPICPNLQAGE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.06 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|