C5Cl5F5N4 — CID 87664496
1-(1,1,2,2,2-pentachloroethyl)-5-(1,1,2,2,2-pentafluoroethyl)tetrazole (PubChem CID 87664496) has the molecular formula C5Cl5F5N4 and a molecular weight of 388.34 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentachloroethyl)-5-(1,1,2,2,2-pentafluoroethyl)tetrazole.
| Compound Name | 1-(1,1,2,2,2-pentachloroethyl)-5-(1,1,2,2,2-pentafluoroethyl)tetrazole |
|---|---|
| PubChem CID | 87664496 |
| Molecular Formula | C5Cl5F5N4 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 385.85 |
| IUPAC Name | 1-(1,1,2,2,2-pentachloroethyl)-5-(1,1,2,2,2-pentafluoroethyl)tetrazole |
| SMILES | FC(F)(F)C(F)(F)c1nnnn1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5Cl5F5N4/c6-3(7,8)4(9,10)19-1(16-17-18-19)2(11,12)5(13,14)15 |
| InChIKey | JCAKVQNENZLUCQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|