C7H8F4N4O2 — CID 79660294
2-methyl-2-[5-(1,1,2,2-tetrafluoroethyl)tetrazol-1-yl]propanoic acid (PubChem CID 79660294) has the molecular formula C7H8F4N4O2 and a molecular weight of 256.16 g/mol. Its IUPAC name is 2-methyl-2-[5-(1,1,2,2-tetrafluoroethyl)tetrazol-1-yl]propanoic acid.
| Compound Name | 2-methyl-2-[5-(1,1,2,2-tetrafluoroethyl)tetrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 79660294 |
| Molecular Formula | C7H8F4N4O2 |
| Molecular Weight | 256.16 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 2-methyl-2-[5-(1,1,2,2-tetrafluoroethyl)tetrazol-1-yl]propanoic acid |
| SMILES | CC(C)(C(=O)O)n1nnnc1C(F)(F)C(F)F |
| InChI | InChI=1S/C7H8F4N4O2/c1-6(2,5(16)17)15-4(12-13-14-15)7(10,11)3(8)9/h3H,1-2H3,(H,16,17) |
| InChIKey | OFYPLNZTFXRMLI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|