C5H3F7N4 — CID 59530193
5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methyltetrazole (PubChem CID 59530193) has the molecular formula C5H3F7N4 and a molecular weight of 252.09 g/mol. Its IUPAC name is 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methyltetrazole.
| Compound Name | 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methyltetrazole |
|---|---|
| PubChem CID | 59530193 |
| Molecular Formula | C5H3F7N4 |
| Molecular Weight | 252.09 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methyltetrazole |
| SMILES | Cn1nnnc1C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H3F7N4/c1-16-2(13-14-15-16)3(6,4(7,8)9)5(10,11)12/h1H3 |
| InChIKey | LOUXBTQSOYAUKG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.09 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |