C3Cl6N4 — CID 87665440
1,5-bis(trichloromethyl)tetrazole (PubChem CID 87665440) has the molecular formula C3Cl6N4 and a molecular weight of 304.78 g/mol. Its IUPAC name is 1,5-bis(trichloromethyl)tetrazole.
| Compound Name | 1,5-bis(trichloromethyl)tetrazole |
|---|---|
| PubChem CID | 87665440 |
| Molecular Formula | C3Cl6N4 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 301.83 |
| IUPAC Name | 1,5-bis(trichloromethyl)tetrazole |
| SMILES | ClC(Cl)(Cl)c1nnnn1C(Cl)(Cl)Cl |
| InChI | InChI=1S/C3Cl6N4/c4-2(5,6)1-10-11-12-13(1)3(7,8)9 |
| InChIKey | YZISISMQRKKKKX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|